C43H46FNO11 — CID 59911612
[(10R)-15-(3-benzamido-2-hydroxy-3-phenylpropanoyl)oxy-9-fluoro-1,4,12-trihydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate (PubChem CID 59911612) has the molecular formula C43H46FNO11 and a molecular weight of 771.84 g/mol. Its IUPAC name is [(10R)-15-(3-benzamido-2-hydroxy-3-phenylpropanoyl)oxy-9-fluoro-1,4,12-trihydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate.
| Compound Name | [(10R)-15-(3-benzamido-2-hydroxy-3-phenylpropanoyl)oxy-9-fluoro-1,4,12-trihydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate |
|---|---|
| PubChem CID | 59911612 |
| Molecular Formula | C43H46FNO11 |
| Molecular Weight | 771.84 g/mol |
| Exact Mass | 771.31 |
| IUPAC Name | [(10R)-15-(3-benzamido-2-hydroxy-3-phenylpropanoyl)oxy-9-fluoro-1,4,12-trihydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate |
| SMILES | CC1=C2C(O)C(=O)[C@]3(C)C(F)CC4OCC4(O)C3C(OC(=O)c3ccccc3)C(O)(CC1OC(=O)C(O)C(NC(=O)c1ccccc1)c1ccccc1)C2(C)C |
| InChI | InChI=1S/C43H46FNO11/c1-23-27(55-39(51)33(47)31(24-14-8-5-9-15-24)45-37(49)25-16-10-6-11-17-25)21-43(53)36(56-38(50)26-18-12-7-13-19-26)34-41(4,28(44)20-29-42(34,52)22-54-29)35(48)32(46)30(23)40(43,2)3/h5-19,27-29,31-34,36,46-47,52-53H,20-22H2,1-4H3,(H,45,49)/t27?,28?,29?,31?,32?,33?,34?,36?,41-,42?,43?/m1/s1 |
| InChIKey | WZFGHVFNCBHCSE-WGERBNOVSA-N |
| XLogP | 3.57 |
| TPSA | 188.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.84 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|