C39H48AcO10 — CID 59962598
actinium;[(10S)-1,4,9-trihydroxy-12-methoxy-10,14,17,17-tetramethyl-15-[(2R,3R)-2-methyl-3-phenylbutanoyl]oxy-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate (PubChem CID 59962598) has the molecular formula C39H48AcO10 and a molecular weight of 903.80 g/mol. Its IUPAC name is actinium;[(10S)-1,4,9-trihydroxy-12-methoxy-10,14,17,17-tetramethyl-15-[(2R,3R)-2-methyl-3-phenylbutanoyl]oxy-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate.
| Compound Name | actinium;[(10S)-1,4,9-trihydroxy-12-methoxy-10,14,17,17-tetramethyl-15-[(2R,3R)-2-methyl-3-phenylbutanoyl]oxy-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate |
|---|---|
| PubChem CID | 59962598 |
| Molecular Formula | C39H48AcO10 |
| Molecular Weight | 903.80 g/mol |
| Exact Mass | 903.35 |
| IUPAC Name | actinium;[(10S)-1,4,9-trihydroxy-12-methoxy-10,14,17,17-tetramethyl-15-[(2R,3R)-2-methyl-3-phenylbutanoyl]oxy-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate |
| SMILES | COC1C(=O)[C@]2(C)C(O)CC3OCC3(O)C2C(OC(=O)c2ccccc2)C2(O)CC(OC(=O)[C@H](C)[C@@H](C)c3ccccc3)C(C)=C1C2(C)C.[Ac] |
| InChI | InChI=1S/C39H48O10.Ac/c1-21(24-14-10-8-11-15-24)22(2)34(42)48-26-19-39(45)33(49-35(43)25-16-12-9-13-17-25)31-37(6,27(40)18-28-38(31,44)20-47-28)32(41)30(46-7)29(23(26)3)36(39,4)5;/h8-17,21-22,26-28,30-31,33,40,44-45H,18-20H2,1-7H3;/t21-,22-,26?,27?,28?,30?,31?,33?,37-,38?,39?;/m1./s1 |
| InChIKey | XIGBSJUMXSIIII-PNPSQOOHSA-N |
| XLogP | 4.16 |
| TPSA | 148.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 903.80 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|