C31H42AcO9 — CID 20673501
actinium;(1,4,9,12-tetrahydroxy-2,10,14,17,17-pentamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl) 2-hydroxy-3-phenylbutanoate (PubChem CID 20673501) has the molecular formula C31H42AcO9 and a molecular weight of 785.67 g/mol. Its IUPAC name is actinium;(1,4,9,12-tetrahydroxy-2,10,14,17,17-pentamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl) 2-hydroxy-3-phenylbutanoate.
| Compound Name | actinium;(1,4,9,12-tetrahydroxy-2,10,14,17,17-pentamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl) 2-hydroxy-3-phenylbutanoate |
|---|---|
| PubChem CID | 20673501 |
| Molecular Formula | C31H42AcO9 |
| Molecular Weight | 785.67 g/mol |
| Exact Mass | 785.31 |
| IUPAC Name | actinium;(1,4,9,12-tetrahydroxy-2,10,14,17,17-pentamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl) 2-hydroxy-3-phenylbutanoate |
| SMILES | CC1=C2C(O)C(=O)C3(C)C(O)CC4OCC4(O)C3C(C)C(O)(CC1OC(=O)C(O)C(C)c1ccccc1)C2(C)C.[Ac] |
| InChI | InChI=1S/C31H42O9.Ac/c1-15(18-10-8-7-9-11-18)23(33)27(36)40-19-13-31(38)17(3)25-29(6,20(32)12-21-30(25,37)14-39-21)26(35)24(34)22(16(19)2)28(31,4)5;/h7-11,15,17,19-21,23-25,32-34,37-38H,12-14H2,1-6H3; |
| InChIKey | NYABFMZWPURTAA-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 153.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.67 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|