C27H43NO8 — CID 59086491
[(9S,10R)-1,4,12-trihydroxy-2,9,10,14,17,17-hexamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl] 2-hydroxy-3-(methylamino)butanoate (PubChem CID 59086491) has the molecular formula C27H43NO8 and a molecular weight of 509.64 g/mol. Its IUPAC name is [(9S,10R)-1,4,12-trihydroxy-2,9,10,14,17,17-hexamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl] 2-hydroxy-3-(methylamino)butanoate.
| Compound Name | [(9S,10R)-1,4,12-trihydroxy-2,9,10,14,17,17-hexamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl] 2-hydroxy-3-(methylamino)butanoate |
|---|---|
| PubChem CID | 59086491 |
| Molecular Formula | C27H43NO8 |
| Molecular Weight | 509.64 g/mol |
| Exact Mass | 509.30 |
| IUPAC Name | [(9S,10R)-1,4,12-trihydroxy-2,9,10,14,17,17-hexamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl] 2-hydroxy-3-(methylamino)butanoate |
| SMILES | CNC(C)C(O)C(=O)OC1CC2(O)C(C)C3C4(O)COC4C[C@H](C)[C@@]3(C)C(=O)C(O)C(=C1C)C2(C)C |
| InChI | InChI=1S/C27H43NO8/c1-12-9-17-26(33,11-35-17)21-14(3)27(34)10-16(36-23(32)19(29)15(4)28-8)13(2)18(24(27,5)6)20(30)22(31)25(12,21)7/h12,14-17,19-21,28-30,33-34H,9-11H2,1-8H3/t12-,14?,15?,16?,17?,19?,20?,21?,25+,26?,27?/m0/s1 |
| InChIKey | HPCDYKUURWVMQL-MFKJJFIJSA-N |
| XLogP | 0.72 |
| TPSA | 145.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.64 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|