C38H45NO8 — CID 59958283
[(2S,9S,10R)-1,4,12-trihydroxy-2,9,10,14,17,17-hexamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl] (5R)-2,4-diphenyl-4,5-dihydro-1,3-oxazole-5-carboxylate (PubChem CID 59958283) has the molecular formula C38H45NO8 and a molecular weight of 643.78 g/mol. Its IUPAC name is [(2S,9S,10R)-1,4,12-trihydroxy-2,9,10,14,17,17-hexamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl] (5R)-2,4-diphenyl-4,5-dihydro-1,3-oxazole-5-carboxylate.
| Compound Name | [(2S,9S,10R)-1,4,12-trihydroxy-2,9,10,14,17,17-hexamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl] (5R)-2,4-diphenyl-4,5-dihydro-1,3-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 59958283 |
| Molecular Formula | C38H45NO8 |
| Molecular Weight | 643.78 g/mol |
| Exact Mass | 643.31 |
| IUPAC Name | [(2S,9S,10R)-1,4,12-trihydroxy-2,9,10,14,17,17-hexamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl] (5R)-2,4-diphenyl-4,5-dihydro-1,3-oxazole-5-carboxylate |
| SMILES | CC1=C2C(O)C(=O)[C@@]3(C)C([C@H](C)C(O)(CC1OC(=O)[C@@H]1OC(c4ccccc4)=NC1c1ccccc1)C2(C)C)C1(O)COC1C[C@@H]3C |
| InChI | InChI=1S/C38H45NO8/c1-20-17-26-37(43,19-45-26)31-22(3)38(44)18-25(21(2)27(35(38,4)5)29(40)32(41)36(20,31)6)46-34(42)30-28(23-13-9-7-10-14-23)39-33(47-30)24-15-11-8-12-16-24/h7-16,20,22,25-26,28-31,40,43-44H,17-19H2,1-6H3/t20-,22-,25?,26?,28?,29?,30+,31?,36+,37?,38?/m0/s1 |
| InChIKey | ZYAIJQGWMXCLLT-TWIHFTHRSA-N |
| XLogP | 4.33 |
| TPSA | 134.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.78 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|