C22H34O6 — CID 147871592
(4S,9S,10R)-1,4,12,15-tetrahydroxy-2,9,10,14,17,17-hexamethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-11-one (PubChem CID 147871592) has the molecular formula C22H34O6 and a molecular weight of 394.51 g/mol. Its IUPAC name is (4S,9S,10R)-1,4,12,15-tetrahydroxy-2,9,10,14,17,17-hexamethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-11-one.
| Compound Name | (4S,9S,10R)-1,4,12,15-tetrahydroxy-2,9,10,14,17,17-hexamethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-11-one |
|---|---|
| PubChem CID | 147871592 |
| Molecular Formula | C22H34O6 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | (4S,9S,10R)-1,4,12,15-tetrahydroxy-2,9,10,14,17,17-hexamethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-11-one |
| SMILES | CC1=C2C(O)C(=O)[C@@]3(C)C(C(C)C(O)(CC1O)C2(C)C)[C@]1(O)COC1C[C@@H]3C |
| InChI | InChI=1S/C22H34O6/c1-10-7-14-21(26,9-28-14)17-12(3)22(27)8-13(23)11(2)15(19(22,4)5)16(24)18(25)20(10,17)6/h10,12-14,16-17,23-24,26-27H,7-9H2,1-6H3/t10-,12?,13?,14?,16?,17?,20+,21-,22?/m0/s1 |
| InChIKey | TYAONHOAJQMAOK-QDDNIJJISA-N |
| XLogP | 1.20 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|