C23H36AcO5 — CID 59077046
actinium;(2S,9S,10R,12R)-1,4,15-trihydroxy-2,9,10,12,14,17,17-heptamethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-11-one (PubChem CID 59077046) has the molecular formula C23H36AcO5 and a molecular weight of 619.54 g/mol. Its IUPAC name is actinium;(2S,9S,10R,12R)-1,4,15-trihydroxy-2,9,10,12,14,17,17-heptamethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-11-one.
| Compound Name | actinium;(2S,9S,10R,12R)-1,4,15-trihydroxy-2,9,10,12,14,17,17-heptamethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-11-one |
|---|---|
| PubChem CID | 59077046 |
| Molecular Formula | C23H36AcO5 |
| Molecular Weight | 619.54 g/mol |
| Exact Mass | 619.28 |
| IUPAC Name | actinium;(2S,9S,10R,12R)-1,4,15-trihydroxy-2,9,10,12,14,17,17-heptamethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-11-one |
| SMILES | CC1=C2[C@@H](C)C(=O)[C@@]3(C)C(C(C)C(O)(CC1O)C2(C)C)C1(O)COC1C[C@@H]3C.[Ac] |
| InChI | InChI=1S/C23H36O5.Ac/c1-11-8-16-22(26,10-28-16)18-14(4)23(27)9-15(24)12(2)17(20(23,5)6)13(3)19(25)21(11,18)7;/h11,13-16,18,24,26-27H,8-10H2,1-7H3;/t11-,13+,14?,15?,16?,18?,21+,22?,23?;/m0./s1 |
| InChIKey | AMAGLDMLWAWEPQ-BSCAQNETSA-N |
| XLogP | 2.47 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.54 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|