C23H34AcO8 — CID 59040364
actinium;[(1S,2S,3R,4S,7R,9S,10R,12R,15S)-1,4,12,15-tetrahydroxy-9,10,14,17,17-pentamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] acetate (PubChem CID 59040364) has the molecular formula C23H34AcO8 and a molecular weight of 665.52 g/mol. Its IUPAC name is actinium;[(1S,2S,3R,4S,7R,9S,10R,12R,15S)-1,4,12,15-tetrahydroxy-9,10,14,17,17-pentamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] acetate.
| Compound Name | actinium;[(1S,2S,3R,4S,7R,9S,10R,12R,15S)-1,4,12,15-tetrahydroxy-9,10,14,17,17-pentamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] acetate |
|---|---|
| PubChem CID | 59040364 |
| Molecular Formula | C23H34AcO8 |
| Molecular Weight | 665.52 g/mol |
| Exact Mass | 665.25 |
| IUPAC Name | actinium;[(1S,2S,3R,4S,7R,9S,10R,12R,15S)-1,4,12,15-tetrahydroxy-9,10,14,17,17-pentamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@@H]2[C@]3(O)CO[C@@H]3C[C@H](C)[C@@]2(C)C(=O)[C@H](O)C2=C(C)[C@@H](O)C[C@]1(O)C2(C)C.[Ac] |
| InChI | InChI=1S/C23H34O8.Ac/c1-10-7-14-22(28,9-30-14)17-19(31-12(3)24)23(29)8-13(25)11(2)15(20(23,4)5)16(26)18(27)21(10,17)6;/h10,13-14,16-17,19,25-26,28-29H,7-9H2,1-6H3;/t10-,13-,14+,16+,17-,19-,21+,22-,23+;/m0./s1 |
| InChIKey | FQCCNXFAWAPIRR-NSOWLIPNSA-N |
| XLogP | 0.49 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.52 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|