C22H34O9 — CID 59040348
[(1S,4S,7R,9S,10S,11S,12R,15S)-1,4,9,11,12,15-hexahydroxy-10,14,17,17-tetramethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] acetate (PubChem CID 59040348) has the molecular formula C22H34O9 and a molecular weight of 442.51 g/mol. Its IUPAC name is [(1S,4S,7R,9S,10S,11S,12R,15S)-1,4,9,11,12,15-hexahydroxy-10,14,17,17-tetramethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] acetate.
| Compound Name | [(1S,4S,7R,9S,10S,11S,12R,15S)-1,4,9,11,12,15-hexahydroxy-10,14,17,17-tetramethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] acetate |
|---|---|
| PubChem CID | 59040348 |
| Molecular Formula | C22H34O9 |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | [(1S,4S,7R,9S,10S,11S,12R,15S)-1,4,9,11,12,15-hexahydroxy-10,14,17,17-tetramethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] acetate |
| SMILES | CC(=O)OC1C2[C@](C)([C@H](O)[C@H](O)C3=C(C)[C@@H](O)C[C@]1(O)C3(C)C)[C@@H](O)C[C@H]1OC[C@@]21O |
| InChI | InChI=1S/C22H34O9/c1-9-11(24)7-22(29)18(31-10(2)23)16-20(5,12(25)6-13-21(16,28)8-30-13)17(27)15(26)14(9)19(22,3)4/h11-13,15-18,24-29H,6-8H2,1-5H3/t11-,12-,13+,15+,16?,17+,18?,20+,21-,22+/m0/s1 |
| InChIKey | WCVAKKOSXYQUPF-QSWCYIPOSA-N |
| XLogP | -0.99 |
| TPSA | 156.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|