C30H40O9 — CID 158549916
[(1S,4S,7R,9S,10R,11R,12R,15S)-4-acetyloxy-1,11,12,15-tetrahydroxy-9,10,14,17,17-pentamethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate (PubChem CID 158549916) has the molecular formula C30H40O9 and a molecular weight of 544.64 g/mol. Its IUPAC name is [(1S,4S,7R,9S,10R,11R,12R,15S)-4-acetyloxy-1,11,12,15-tetrahydroxy-9,10,14,17,17-pentamethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate.
| Compound Name | [(1S,4S,7R,9S,10R,11R,12R,15S)-4-acetyloxy-1,11,12,15-tetrahydroxy-9,10,14,17,17-pentamethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate |
|---|---|
| PubChem CID | 158549916 |
| Molecular Formula | C30H40O9 |
| Molecular Weight | 544.64 g/mol |
| Exact Mass | 544.27 |
| IUPAC Name | [(1S,4S,7R,9S,10R,11R,12R,15S)-4-acetyloxy-1,11,12,15-tetrahydroxy-9,10,14,17,17-pentamethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate |
| SMILES | CC(=O)O[C@@]12CO[C@@H]1C[C@H](C)[C@]1(C)C2C(OC(=O)c2ccccc2)[C@]2(O)C[C@H](O)C(C)=C([C@@H](O)[C@@H]1O)C2(C)C |
| InChI | InChI=1S/C30H40O9/c1-15-12-20-29(14-37-20,39-17(3)31)23-25(38-26(35)18-10-8-7-9-11-18)30(36)13-19(32)16(2)21(27(30,4)5)22(33)24(34)28(15,23)6/h7-11,15,19-20,22-25,32-34,36H,12-14H2,1-6H3/t15-,19-,20+,22+,23?,24-,25?,28+,29-,30+/m0/s1 |
| InChIKey | LKJOOWFWRDEVII-XWSBAPSYSA-N |
| XLogP | 2.15 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.64 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|