C36H54O9Si — CID 174139598
[(1S,2S,3R,4S,7R,10R,11R,12S)-4-acetyloxy-1,11,12-trihydroxy-10,14,15,17,17-pentamethyl-9-triethylsilyloxy-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate (PubChem CID 174139598) has the molecular formula C36H54O9Si and a molecular weight of 658.91 g/mol. Its IUPAC name is [(1S,2S,3R,4S,7R,10R,11R,12S)-4-acetyloxy-1,11,12-trihydroxy-10,14,15,17,17-pentamethyl-9-triethylsilyloxy-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate.
| Compound Name | [(1S,2S,3R,4S,7R,10R,11R,12S)-4-acetyloxy-1,11,12-trihydroxy-10,14,15,17,17-pentamethyl-9-triethylsilyloxy-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate |
|---|---|
| PubChem CID | 174139598 |
| Molecular Formula | C36H54O9Si |
| Molecular Weight | 658.91 g/mol |
| Exact Mass | 658.35 |
| IUPAC Name | [(1S,2S,3R,4S,7R,10R,11R,12S)-4-acetyloxy-1,11,12-trihydroxy-10,14,15,17,17-pentamethyl-9-triethylsilyloxy-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate |
| SMILES | CC[Si](CC)(CC)OC1C[C@H]2OC[C@@]2(OC(C)=O)[C@H]2[C@H](OC(=O)c3ccccc3)[C@]3(O)CC(C)C(C)=C([C@H](O)[C@H](O)[C@]12C)C3(C)C |
| InChI | InChI=1S/C36H54O9Si/c1-10-46(11-2,12-3)45-25-18-26-35(20-42-26,44-23(6)37)29-31(43-32(40)24-16-14-13-15-17-24)36(41)19-21(4)22(5)27(33(36,7)8)28(38)30(39)34(25,29)9/h13-17,21,25-26,28-31,38-39,41H,10-12,18-20H2,1-9H3/t21?,25?,26-,28+,29+,30+,31+,34-,35+,36-/m1/s1 |
| InChIKey | UIRQAEYCRRLOEJ-NKIDEOTKSA-N |
| XLogP | 5.18 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.91 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|