C32H42O10 — CID 158090359
[(1S,4S,7R,9S,10R,11S,12R,15S)-4,11-diacetyloxy-1,12,15-trihydroxy-9,10,14,17,17-pentamethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate (PubChem CID 158090359) has the molecular formula C32H42O10 and a molecular weight of 586.68 g/mol. Its IUPAC name is [(1S,4S,7R,9S,10R,11S,12R,15S)-4,11-diacetyloxy-1,12,15-trihydroxy-9,10,14,17,17-pentamethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate.
| Compound Name | [(1S,4S,7R,9S,10R,11S,12R,15S)-4,11-diacetyloxy-1,12,15-trihydroxy-9,10,14,17,17-pentamethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate |
|---|---|
| PubChem CID | 158090359 |
| Molecular Formula | C32H42O10 |
| Molecular Weight | 586.68 g/mol |
| Exact Mass | 586.28 |
| IUPAC Name | [(1S,4S,7R,9S,10R,11S,12R,15S)-4,11-diacetyloxy-1,12,15-trihydroxy-9,10,14,17,17-pentamethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate |
| SMILES | CC(=O)O[C@@H]1[C@H](O)C2=C(C)[C@@H](O)C[C@@](O)(C(OC(=O)c3ccccc3)C3[C@@]1(C)[C@@H](C)C[C@H]1OC[C@@]31OC(C)=O)C2(C)C |
| InChI | InChI=1S/C32H42O10/c1-16-13-22-31(15-39-22,42-19(4)34)25-27(41-28(37)20-11-9-8-10-12-20)32(38)14-21(35)17(2)23(29(32,5)6)24(36)26(30(16,25)7)40-18(3)33/h8-12,16,21-22,24-27,35-36,38H,13-15H2,1-7H3/t16-,21-,22+,24+,25?,26+,27?,30+,31-,32+/m0/s1 |
| InChIKey | RVYRXKACKVKMDO-NAZNIAOVSA-N |
| XLogP | 2.72 |
| TPSA | 148.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.68 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|