C36H52O9Si — CID 158975385
[(1R,4S,7R,9S,10R,11S,12R,15S)-4,11-diacetyloxy-12-hydroxy-1,9,10,14,17,17-hexamethyl-15-trimethylsilyloxy-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate (PubChem CID 158975385) has the molecular formula C36H52O9Si and a molecular weight of 656.89 g/mol. Its IUPAC name is [(1R,4S,7R,9S,10R,11S,12R,15S)-4,11-diacetyloxy-12-hydroxy-1,9,10,14,17,17-hexamethyl-15-trimethylsilyloxy-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate.
| Compound Name | [(1R,4S,7R,9S,10R,11S,12R,15S)-4,11-diacetyloxy-12-hydroxy-1,9,10,14,17,17-hexamethyl-15-trimethylsilyloxy-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate |
|---|---|
| PubChem CID | 158975385 |
| Molecular Formula | C36H52O9Si |
| Molecular Weight | 656.89 g/mol |
| Exact Mass | 656.34 |
| IUPAC Name | [(1R,4S,7R,9S,10R,11S,12R,15S)-4,11-diacetyloxy-12-hydroxy-1,9,10,14,17,17-hexamethyl-15-trimethylsilyloxy-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate |
| SMILES | CC(=O)O[C@@H]1[C@H](O)C2=C(C)[C@@H](O[Si](C)(C)C)C[C@@](C)(C(OC(=O)c3ccccc3)C3[C@@]1(C)[C@@H](C)C[C@H]1OC[C@@]31OC(C)=O)C2(C)C |
| InChI | InChI=1S/C36H52O9Si/c1-20-17-26-36(19-41-26,44-23(4)38)29-31(43-32(40)24-15-13-12-14-16-24)34(7)18-25(45-46(9,10)11)21(2)27(33(34,5)6)28(39)30(35(20,29)8)42-22(3)37/h12-16,20,25-26,28-31,39H,17-19H2,1-11H3/t20-,25-,26+,28+,29?,30+,31?,34-,35+,36-/m0/s1 |
| InChIKey | HUVNBIFAIZUPHY-YVZRGIFHSA-N |
| XLogP | 5.85 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.89 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|