C33H40O11 — CID 10393985
[(1S,2S,3R,4S,7R,9S,10S,11R,14S)-4,11,14-triacetyloxy-10-formyl-1-hydroxy-9,13,16,16-tetramethyl-6-oxatetracyclo[10.3.1.03,10.04,7]hexadec-12-en-2-yl] benzoate (PubChem CID 10393985) has the molecular formula C33H40O11 and a molecular weight of 612.67 g/mol. Its IUPAC name is [(1S,2S,3R,4S,7R,9S,10S,11R,14S)-4,11,14-triacetyloxy-10-formyl-1-hydroxy-9,13,16,16-tetramethyl-6-oxatetracyclo[10.3.1.03,10.04,7]hexadec-12-en-2-yl] benzoate.
| Compound Name | [(1S,2S,3R,4S,7R,9S,10S,11R,14S)-4,11,14-triacetyloxy-10-formyl-1-hydroxy-9,13,16,16-tetramethyl-6-oxatetracyclo[10.3.1.03,10.04,7]hexadec-12-en-2-yl] benzoate |
|---|---|
| PubChem CID | 10393985 |
| Molecular Formula | C33H40O11 |
| Molecular Weight | 612.67 g/mol |
| Exact Mass | 612.26 |
| IUPAC Name | [(1S,2S,3R,4S,7R,9S,10S,11R,14S)-4,11,14-triacetyloxy-10-formyl-1-hydroxy-9,13,16,16-tetramethyl-6-oxatetracyclo[10.3.1.03,10.04,7]hexadec-12-en-2-yl] benzoate |
| SMILES | CC(=O)O[C@H]1C[C@@]2(O)[C@@H](OC(=O)c3ccccc3)[C@@H]3[C@]4(OC(C)=O)CO[C@@H]4C[C@H](C)[C@@]3(C=O)[C@H](OC(C)=O)C(=C1C)C2(C)C |
| InChI | InChI=1S/C33H40O11/c1-17-13-24-32(16-40-24,44-21(5)37)26-28(43-29(38)22-11-9-8-10-12-22)33(39)14-23(41-19(3)35)18(2)25(30(33,6)7)27(42-20(4)36)31(17,26)15-34/h8-12,15,17,23-24,26-28,39H,13-14,16H2,1-7H3/t17-,23-,24+,26-,27+,28-,31+,32-,33+/m0/s1 |
| InChIKey | FXWQMHQAOGKVDX-CTJIHKEOSA-N |
| XLogP | 3.11 |
| TPSA | 151.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.67 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|