C35H48O10Si — CID 91210854
[(1S,4S,7R,9S,10R,11S,15S)-4,11-diacetyloxy-1-hydroxy-9,10,14,17,17-pentamethyl-12-oxo-15-trimethylsilyloxy-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate (PubChem CID 91210854) has the molecular formula C35H48O10Si and a molecular weight of 656.85 g/mol. Its IUPAC name is [(1S,4S,7R,9S,10R,11S,15S)-4,11-diacetyloxy-1-hydroxy-9,10,14,17,17-pentamethyl-12-oxo-15-trimethylsilyloxy-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate.
| Compound Name | [(1S,4S,7R,9S,10R,11S,15S)-4,11-diacetyloxy-1-hydroxy-9,10,14,17,17-pentamethyl-12-oxo-15-trimethylsilyloxy-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate |
|---|---|
| PubChem CID | 91210854 |
| Molecular Formula | C35H48O10Si |
| Molecular Weight | 656.85 g/mol |
| Exact Mass | 656.30 |
| IUPAC Name | [(1S,4S,7R,9S,10R,11S,15S)-4,11-diacetyloxy-1-hydroxy-9,10,14,17,17-pentamethyl-12-oxo-15-trimethylsilyloxy-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate |
| SMILES | CC(=O)O[C@@H]1C(=O)C2=C(C)[C@@H](O[Si](C)(C)C)C[C@@](O)(C(OC(=O)c3ccccc3)C3[C@@]1(C)[C@@H](C)C[C@H]1OC[C@@]31OC(C)=O)C2(C)C |
| InChI | InChI=1S/C35H48O10Si/c1-19-16-25-34(18-41-25,44-22(4)37)28-30(43-31(39)23-14-12-11-13-15-23)35(40)17-24(45-46(8,9)10)20(2)26(32(35,5)6)27(38)29(33(19,28)7)42-21(3)36/h11-15,19,24-25,28-30,40H,16-18H2,1-10H3/t19-,24-,25+,28?,29+,30?,33+,34-,35+/m0/s1 |
| InChIKey | MSQGZBVMIKERRI-XNOMLWRDSA-N |
| XLogP | 4.79 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.85 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|