C32H44O9 — CID 59933215
[(9S,10R)-4-acetyloxy-1,11-dihydroxy-12,15-dimethoxy-9,10,14,17,17-pentamethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate (PubChem CID 59933215) has the molecular formula C32H44O9 and a molecular weight of 572.70 g/mol. Its IUPAC name is [(9S,10R)-4-acetyloxy-1,11-dihydroxy-12,15-dimethoxy-9,10,14,17,17-pentamethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate.
| Compound Name | [(9S,10R)-4-acetyloxy-1,11-dihydroxy-12,15-dimethoxy-9,10,14,17,17-pentamethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate |
|---|---|
| PubChem CID | 59933215 |
| Molecular Formula | C32H44O9 |
| Molecular Weight | 572.70 g/mol |
| Exact Mass | 572.30 |
| IUPAC Name | [(9S,10R)-4-acetyloxy-1,11-dihydroxy-12,15-dimethoxy-9,10,14,17,17-pentamethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate |
| SMILES | COC1CC2(O)C(OC(=O)c3ccccc3)C3C4(OC(C)=O)COC4C[C@H](C)[C@@]3(C)C(O)C(OC)C(=C1C)C2(C)C |
| InChI | InChI=1S/C32H44O9/c1-17-14-22-31(16-39-22,41-19(3)33)25-27(40-28(35)20-12-10-9-11-13-20)32(36)15-21(37-7)18(2)23(29(32,4)5)24(38-8)26(34)30(17,25)6/h9-13,17,21-22,24-27,34,36H,14-16H2,1-8H3/t17-,21?,22?,24?,25?,26?,27?,30+,31?,32?/m0/s1 |
| InChIKey | ZLTRQEQSIXNIHS-DYXNBUEISA-N |
| XLogP | 3.46 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.70 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|