C22H32O8 — CID 59055843
[(1S,2S,5S,7S,8R,10R,13S)-1,5,10,13-tetrahydroxy-7,8,12,15,15-pentamethyl-4,9-dioxo-2-tricyclo[9.3.1.03,8]pentadec-11-enyl] acetate (PubChem CID 59055843) has the molecular formula C22H32O8 and a molecular weight of 424.49 g/mol. Its IUPAC name is [(1S,2S,5S,7S,8R,10R,13S)-1,5,10,13-tetrahydroxy-7,8,12,15,15-pentamethyl-4,9-dioxo-2-tricyclo[9.3.1.03,8]pentadec-11-enyl] acetate.
| Compound Name | [(1S,2S,5S,7S,8R,10R,13S)-1,5,10,13-tetrahydroxy-7,8,12,15,15-pentamethyl-4,9-dioxo-2-tricyclo[9.3.1.03,8]pentadec-11-enyl] acetate |
|---|---|
| PubChem CID | 59055843 |
| Molecular Formula | C22H32O8 |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | [(1S,2S,5S,7S,8R,10R,13S)-1,5,10,13-tetrahydroxy-7,8,12,15,15-pentamethyl-4,9-dioxo-2-tricyclo[9.3.1.03,8]pentadec-11-enyl] acetate |
| SMILES | CC(=O)O[C@H]1C2C(=O)[C@@H](O)C[C@H](C)[C@@]2(C)C(=O)[C@H](O)C2=C(C)[C@@H](O)C[C@]1(O)C2(C)C |
| InChI | InChI=1S/C22H32O8/c1-9-7-12(24)16(26)15-19(30-11(3)23)22(29)8-13(25)10(2)14(20(22,4)5)17(27)18(28)21(9,15)6/h9,12-13,15,17,19,24-25,27,29H,7-8H2,1-6H3/t9-,12-,13-,15?,17+,19-,21+,22+/m0/s1 |
| InChIKey | WXWFJTLHRIDHKI-LLDXBOIISA-N |
| XLogP | 0.29 |
| TPSA | 141.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|