C29H38O11 — CID 56968586
[(1S,2S,3R,4S,5S,7S,8S,10R,13S)-5-acetyloxy-1,4,7,10,13-pentahydroxy-4-(hydroxymethyl)-8,12,15,15-tetramethyl-9-oxo-2-tricyclo[9.3.1.03,8]pentadec-11-enyl] benzoate (PubChem CID 56968586) has the molecular formula C29H38O11 and a molecular weight of 562.61 g/mol. Its IUPAC name is [(1S,2S,3R,4S,5S,7S,8S,10R,13S)-5-acetyloxy-1,4,7,10,13-pentahydroxy-4-(hydroxymethyl)-8,12,15,15-tetramethyl-9-oxo-2-tricyclo[9.3.1.03,8]pentadec-11-enyl] benzoate.
| Compound Name | [(1S,2S,3R,4S,5S,7S,8S,10R,13S)-5-acetyloxy-1,4,7,10,13-pentahydroxy-4-(hydroxymethyl)-8,12,15,15-tetramethyl-9-oxo-2-tricyclo[9.3.1.03,8]pentadec-11-enyl] benzoate |
|---|---|
| PubChem CID | 56968586 |
| Molecular Formula | C29H38O11 |
| Molecular Weight | 562.61 g/mol |
| Exact Mass | 562.24 |
| IUPAC Name | [(1S,2S,3R,4S,5S,7S,8S,10R,13S)-5-acetyloxy-1,4,7,10,13-pentahydroxy-4-(hydroxymethyl)-8,12,15,15-tetramethyl-9-oxo-2-tricyclo[9.3.1.03,8]pentadec-11-enyl] benzoate |
| SMILES | CC(=O)O[C@H]1C[C@H](O)[C@@]2(C)C(=O)[C@H](O)C3=C(C)[C@@H](O)C[C@@](O)([C@@H](OC(=O)c4ccccc4)[C@@H]2[C@]1(O)CO)C3(C)C |
| InChI | InChI=1S/C29H38O11/c1-14-17(32)12-29(38)24(40-25(36)16-9-7-6-8-10-16)22-27(5,23(35)21(34)20(14)26(29,3)4)18(33)11-19(39-15(2)31)28(22,37)13-30/h6-10,17-19,21-22,24,30,32-34,37-38H,11-13H2,1-5H3/t17-,18-,19-,21+,22-,24-,27+,28-,29+/m0/s1 |
| InChIKey | ZTIGMYXBKDJGFW-AVRXCUEASA-N |
| XLogP | 0.04 |
| TPSA | 191.05 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.61 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|