C32H42O9S2 — CID 59035295
[(1S,2S,3R,4R,5R,7S,8S,10R,13S)-4-acetyloxy-4-ethyl-1,5,10,13-tetrahydroxy-8,12,15,15-tetramethyl-7-methylsulfanylcarbothioyl-9-oxo-2-tricyclo[9.3.1.03,8]pentadec-11-enyl] benzoate (PubChem CID 59035295) has the molecular formula C32H42O9S2 and a molecular weight of 634.81 g/mol. Its IUPAC name is [(1S,2S,3R,4R,5R,7S,8S,10R,13S)-4-acetyloxy-4-ethyl-1,5,10,13-tetrahydroxy-8,12,15,15-tetramethyl-7-methylsulfanylcarbothioyl-9-oxo-2-tricyclo[9.3.1.03,8]pentadec-11-enyl] benzoate.
| Compound Name | [(1S,2S,3R,4R,5R,7S,8S,10R,13S)-4-acetyloxy-4-ethyl-1,5,10,13-tetrahydroxy-8,12,15,15-tetramethyl-7-methylsulfanylcarbothioyl-9-oxo-2-tricyclo[9.3.1.03,8]pentadec-11-enyl] benzoate |
|---|---|
| PubChem CID | 59035295 |
| Molecular Formula | C32H42O9S2 |
| Molecular Weight | 634.81 g/mol |
| Exact Mass | 634.23 |
| IUPAC Name | [(1S,2S,3R,4R,5R,7S,8S,10R,13S)-4-acetyloxy-4-ethyl-1,5,10,13-tetrahydroxy-8,12,15,15-tetramethyl-7-methylsulfanylcarbothioyl-9-oxo-2-tricyclo[9.3.1.03,8]pentadec-11-enyl] benzoate |
| SMILES | CC[C@]1(OC(C)=O)[C@H](O)C[C@H](C(=S)SC)[C@@]2(C)C(=O)[C@H](O)C3=C(C)[C@@H](O)C[C@@](O)([C@@H](OC(=O)c4ccccc4)[C@H]12)C3(C)C |
| InChI | InChI=1S/C32H42O9S2/c1-8-31(41-17(3)33)21(35)14-19(28(42)43-7)30(6)24(31)26(40-27(38)18-12-10-9-11-13-18)32(39)15-20(34)16(2)22(29(32,4)5)23(36)25(30)37/h9-13,19-21,23-24,26,34-36,39H,8,14-15H2,1-7H3/t19-,20+,21-,23-,24+,26+,30-,31+,32-/m1/s1 |
| InChIKey | DTBBGNKWOBSDDI-XOBUTSOSSA-N |
| XLogP | 3.40 |
| TPSA | 150.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.81 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|