C25H42O6Si — CID 54396429
(9S,10R,12R)-1,2,4-trihydroxy-9,10,12,14,17,17-hexamethyl-15-trimethylsilyloxy-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-11-one (PubChem CID 54396429) has the molecular formula C25H42O6Si and a molecular weight of 466.69 g/mol. Its IUPAC name is (9S,10R,12R)-1,2,4-trihydroxy-9,10,12,14,17,17-hexamethyl-15-trimethylsilyloxy-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-11-one.
| Compound Name | (9S,10R,12R)-1,2,4-trihydroxy-9,10,12,14,17,17-hexamethyl-15-trimethylsilyloxy-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-11-one |
|---|---|
| PubChem CID | 54396429 |
| Molecular Formula | C25H42O6Si |
| Molecular Weight | 466.69 g/mol |
| Exact Mass | 466.28 |
| IUPAC Name | (9S,10R,12R)-1,2,4-trihydroxy-9,10,12,14,17,17-hexamethyl-15-trimethylsilyloxy-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-11-one |
| SMILES | CC1=C2[C@@H](C)C(=O)[C@@]3(C)C(C(O)C(O)(CC1O[Si](C)(C)C)C2(C)C)C1(O)COC1C[C@@H]3C |
| InChI | InChI=1S/C25H42O6Si/c1-13-10-17-24(28,12-30-17)19-21(27)25(29)11-16(31-32(7,8)9)14(2)18(22(25,4)5)15(3)20(26)23(13,19)6/h13,15-17,19,21,27-29H,10-12H2,1-9H3/t13-,15+,16?,17?,19?,21?,23+,24?,25?/m0/s1 |
| InChIKey | VKHHXDCVRKRXBK-LEBODACOSA-N |
| XLogP | 3.06 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.69 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|