C35H48O8 — CID 59958278
[(2S,9S,10R)-1,4,12-trihydroxy-2,9,10,14,17,17-hexamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl] (2R)-5,5-dimethyl-3-phenyloxolane-2-carboxylate (PubChem CID 59958278) has the molecular formula C35H48O8 and a molecular weight of 596.76 g/mol. Its IUPAC name is [(2S,9S,10R)-1,4,12-trihydroxy-2,9,10,14,17,17-hexamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl] (2R)-5,5-dimethyl-3-phenyloxolane-2-carboxylate.
| Compound Name | [(2S,9S,10R)-1,4,12-trihydroxy-2,9,10,14,17,17-hexamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl] (2R)-5,5-dimethyl-3-phenyloxolane-2-carboxylate |
|---|---|
| PubChem CID | 59958278 |
| Molecular Formula | C35H48O8 |
| Molecular Weight | 596.76 g/mol |
| Exact Mass | 596.33 |
| IUPAC Name | [(2S,9S,10R)-1,4,12-trihydroxy-2,9,10,14,17,17-hexamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl] (2R)-5,5-dimethyl-3-phenyloxolane-2-carboxylate |
| SMILES | CC1=C2C(O)C(=O)[C@@]3(C)C([C@H](C)C(O)(CC1OC(=O)[C@@H]1OC(C)(C)CC1c1ccccc1)C2(C)C)C1(O)COC1C[C@@H]3C |
| InChI | InChI=1S/C35H48O8/c1-18-14-24-34(39,17-41-24)28-20(3)35(40)16-23(19(2)25(32(35,6)7)26(36)29(37)33(18,28)8)42-30(38)27-22(15-31(4,5)43-27)21-12-10-9-11-13-21/h9-13,18,20,22-24,26-28,36,39-40H,14-17H2,1-8H3/t18-,20-,22?,23?,24?,26?,27+,28?,33+,34?,35?/m0/s1 |
| InChIKey | PTSBPRIOSOBGTE-GSODYSBYSA-N |
| XLogP | 4.10 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.76 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|