C27H41NO10 — CID 59046361
[(1R,2S,3S,4S,7R,9S,10S,12R,15S)-1,4,9,12-tetrahydroxy-2,10,14,17,17-pentamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl] (2R,3S)-3-acetamido-2-hydroxybutanoate (PubChem CID 59046361) has the molecular formula C27H41NO10 and a molecular weight of 539.62 g/mol. Its IUPAC name is [(1R,2S,3S,4S,7R,9S,10S,12R,15S)-1,4,9,12-tetrahydroxy-2,10,14,17,17-pentamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl] (2R,3S)-3-acetamido-2-hydroxybutanoate.
| Compound Name | [(1R,2S,3S,4S,7R,9S,10S,12R,15S)-1,4,9,12-tetrahydroxy-2,10,14,17,17-pentamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl] (2R,3S)-3-acetamido-2-hydroxybutanoate |
|---|---|
| PubChem CID | 59046361 |
| Molecular Formula | C27H41NO10 |
| Molecular Weight | 539.62 g/mol |
| Exact Mass | 539.27 |
| IUPAC Name | [(1R,2S,3S,4S,7R,9S,10S,12R,15S)-1,4,9,12-tetrahydroxy-2,10,14,17,17-pentamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl] (2R,3S)-3-acetamido-2-hydroxybutanoate |
| SMILES | CC(=O)N[C@@H](C)[C@@H](O)C(=O)O[C@H]1C[C@@]2(O)[C@@H](C)[C@@H]3[C@]4(O)CO[C@@H]4C[C@H](O)[C@@]3(C)C(=O)[C@H](O)C(=C1C)C2(C)C |
| InChI | InChI=1S/C27H41NO10/c1-11-15(38-23(34)19(31)13(3)28-14(4)29)9-27(36)12(2)21-25(7,16(30)8-17-26(21,35)10-37-17)22(33)20(32)18(11)24(27,5)6/h12-13,15-17,19-21,30-32,35-36H,8-10H2,1-7H3,(H,28,29)/t12-,13-,15-,16-,17+,19+,20+,21-,25+,26-,27+/m0/s1 |
| InChIKey | HABDISARAVVYDG-XCZQXTQDSA-N |
| XLogP | -0.64 |
| TPSA | 182.85 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.62 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|