C27H43NO8 — CID 59962636
N-[3-hydroxy-4-[(10S,15S)-1,4,9,12-tetrahydroxy-2,10,14,17,17-pentamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl]butan-2-yl]acetamide (PubChem CID 59962636) has the molecular formula C27H43NO8 and a molecular weight of 509.64 g/mol. Its IUPAC name is N-[3-hydroxy-4-[(10S,15S)-1,4,9,12-tetrahydroxy-2,10,14,17,17-pentamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl]butan-2-yl]acetamide.
| Compound Name | N-[3-hydroxy-4-[(10S,15S)-1,4,9,12-tetrahydroxy-2,10,14,17,17-pentamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl]butan-2-yl]acetamide |
|---|---|
| PubChem CID | 59962636 |
| Molecular Formula | C27H43NO8 |
| Molecular Weight | 509.64 g/mol |
| Exact Mass | 509.30 |
| IUPAC Name | N-[3-hydroxy-4-[(10S,15S)-1,4,9,12-tetrahydroxy-2,10,14,17,17-pentamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl]butan-2-yl]acetamide |
| SMILES | CC(=O)NC(C)C(O)C[C@H]1CC2(O)C(C)C3C4(O)COC4CC(O)[C@@]3(C)C(=O)C(O)C(=C1C)C2(C)C |
| InChI | InChI=1S/C27H43NO8/c1-12-16(8-17(30)14(3)28-15(4)29)10-27(35)13(2)22-25(7,18(31)9-19-26(22,34)11-36-19)23(33)21(32)20(12)24(27,5)6/h13-14,16-19,21-22,30-32,34-35H,8-11H2,1-7H3,(H,28,29)/t13?,14?,16-,17?,18?,19?,21?,22?,25+,26?,27?/m0/s1 |
| InChIKey | WIGBUMGJYQISKU-JDEAXHEESA-N |
| XLogP | 0.45 |
| TPSA | 156.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.64 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|