C29H45NO11 — CID 54175538
[(10S)-15-[(1R)-3-acetamido-1-hydroperoxy-2-hydroxybutyl]-1,9,12-trihydroxy-2,10,14,17,17-pentamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-4-yl] acetate (PubChem CID 54175538) has the molecular formula C29H45NO11 and a molecular weight of 583.68 g/mol. Its IUPAC name is [(10S)-15-[(1R)-3-acetamido-1-hydroperoxy-2-hydroxybutyl]-1,9,12-trihydroxy-2,10,14,17,17-pentamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-4-yl] acetate.
| Compound Name | [(10S)-15-[(1R)-3-acetamido-1-hydroperoxy-2-hydroxybutyl]-1,9,12-trihydroxy-2,10,14,17,17-pentamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-4-yl] acetate |
|---|---|
| PubChem CID | 54175538 |
| Molecular Formula | C29H45NO11 |
| Molecular Weight | 583.68 g/mol |
| Exact Mass | 583.30 |
| IUPAC Name | [(10S)-15-[(1R)-3-acetamido-1-hydroperoxy-2-hydroxybutyl]-1,9,12-trihydroxy-2,10,14,17,17-pentamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-4-yl] acetate |
| SMILES | CC(=O)NC(C)C(O)[C@H](OO)C1CC2(O)C(C)C3C4(OC(C)=O)COC4CC(O)[C@@]3(C)C(=O)C(O)C(=C1C)C2(C)C |
| InChI | InChI=1S/C29H45NO11/c1-12-17(23(41-38)21(34)14(3)30-15(4)31)10-29(37)13(2)24-27(8,25(36)22(35)20(12)26(29,6)7)18(33)9-19-28(24,11-39-19)40-16(5)32/h13-14,17-19,21-24,33-35,37-38H,9-11H2,1-8H3,(H,30,31)/t13?,14?,17?,18?,19?,21?,22?,23-,24?,27-,28?,29?/m1/s1 |
| InChIKey | OYBNSBZYUITHNK-ORVAQZIGSA-N |
| XLogP | 0.49 |
| TPSA | 192.08 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.68 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|