C29H47Ac2NO9 — CID 59033450
actinium;methyl N-[4-hydroperoxy-3-methyl-4-[(9S,10R)-1,4,12-trihydroxy-2,9,10,14,17,17-hexamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl]butan-2-yl]carbamate (PubChem CID 59033450) has the molecular formula C29H47Ac2NO9 and a molecular weight of 1007.69 g/mol. Its IUPAC name is actinium;methyl N-[4-hydroperoxy-3-methyl-4-[(9S,10R)-1,4,12-trihydroxy-2,9,10,14,17,17-hexamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl]butan-2-yl]carbamate.
| Compound Name | actinium;methyl N-[4-hydroperoxy-3-methyl-4-[(9S,10R)-1,4,12-trihydroxy-2,9,10,14,17,17-hexamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 59033450 |
| Molecular Formula | C29H47Ac2NO9 |
| Molecular Weight | 1007.69 g/mol |
| Exact Mass | 1007.38 |
| IUPAC Name | actinium;methyl N-[4-hydroperoxy-3-methyl-4-[(9S,10R)-1,4,12-trihydroxy-2,9,10,14,17,17-hexamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl]butan-2-yl]carbamate |
| SMILES | COC(=O)NC(C)C(C)C(OO)C1CC2(O)C(C)C3C4(O)COC4C[C@H](C)[C@@]3(C)C(=O)C(O)C(=C1C)C2(C)C.[Ac].[Ac] |
| InChI | InChI=1S/C29H47NO9.2Ac/c1-13-10-19-28(34,12-38-19)23-16(4)29(35)11-18(22(39-36)14(2)17(5)30-25(33)37-9)15(3)20(26(29,6)7)21(31)24(32)27(13,23)8;;/h13-14,16-19,21-23,31,34-36H,10-12H2,1-9H3,(H,30,33);;/t13-,14?,16?,17?,18?,19?,21?,22?,23?,27+,28?,29?;;/m0../s1 |
| InChIKey | YLPKKHPCVGATRX-SDVBIYIISA-N |
| XLogP | 2.69 |
| TPSA | 154.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 1007.69 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|