C30H47NO10 — CID 59955474
[(2S,10S)-4-acetyloxy-1,9,12-trihydroxy-2,10,14,17,17-pentamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl] 3-(dimethylamino)-2-methoxybutanoate (PubChem CID 59955474) has the molecular formula C30H47NO10 and a molecular weight of 581.70 g/mol. Its IUPAC name is [(2S,10S)-4-acetyloxy-1,9,12-trihydroxy-2,10,14,17,17-pentamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl] 3-(dimethylamino)-2-methoxybutanoate.
| Compound Name | [(2S,10S)-4-acetyloxy-1,9,12-trihydroxy-2,10,14,17,17-pentamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl] 3-(dimethylamino)-2-methoxybutanoate |
|---|---|
| PubChem CID | 59955474 |
| Molecular Formula | C30H47NO10 |
| Molecular Weight | 581.70 g/mol |
| Exact Mass | 581.32 |
| IUPAC Name | [(2S,10S)-4-acetyloxy-1,9,12-trihydroxy-2,10,14,17,17-pentamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl] 3-(dimethylamino)-2-methoxybutanoate |
| SMILES | COC(C(=O)OC1CC2(O)C(C)C3C4(OC(C)=O)COC4CC(O)[C@@]3(C)C(=O)C(O)C(=C1C)C2(C)C)C(C)N(C)C |
| InChI | InChI=1S/C30H47NO10/c1-14-18(40-26(36)23(38-10)16(3)31(8)9)12-30(37)15(2)24-28(7,25(35)22(34)21(14)27(30,5)6)19(33)11-20-29(24,13-39-20)41-17(4)32/h15-16,18-20,22-24,33-34,37H,11-13H2,1-10H3/t15?,16?,18?,19?,20?,22?,23?,24?,28-,29?,30?/m1/s1 |
| InChIKey | LVAPUGMKFZXDEM-QZWLDYPOSA-N |
| XLogP | 1.01 |
| TPSA | 152.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.70 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|