C36H49NO12 — CID 54365276
[(10S)-4-acetyloxy-15-[3-(dimethylamino)-2-methoxybutanoyl]oxy-1,9,12-trihydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate (PubChem CID 54365276) has the molecular formula C36H49NO12 and a molecular weight of 687.78 g/mol. Its IUPAC name is [(10S)-4-acetyloxy-15-[3-(dimethylamino)-2-methoxybutanoyl]oxy-1,9,12-trihydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate.
| Compound Name | [(10S)-4-acetyloxy-15-[3-(dimethylamino)-2-methoxybutanoyl]oxy-1,9,12-trihydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate |
|---|---|
| PubChem CID | 54365276 |
| Molecular Formula | C36H49NO12 |
| Molecular Weight | 687.78 g/mol |
| Exact Mass | 687.33 |
| IUPAC Name | [(10S)-4-acetyloxy-15-[3-(dimethylamino)-2-methoxybutanoyl]oxy-1,9,12-trihydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate |
| SMILES | COC(C(=O)OC1CC2(O)C(OC(=O)c3ccccc3)C3C4(OC(C)=O)COC4CC(O)[C@@]3(C)C(=O)C(O)C(=C1C)C2(C)C)C(C)N(C)C |
| InChI | InChI=1S/C36H49NO12/c1-18-22(47-32(43)27(45-9)19(2)37(7)8)16-36(44)30(48-31(42)21-13-11-10-12-14-21)28-34(6,29(41)26(40)25(18)33(36,4)5)23(39)15-24-35(28,17-46-24)49-20(3)38/h10-14,19,22-24,26-28,30,39-40,44H,15-17H2,1-9H3/t19?,22?,23?,24?,26?,27?,28?,30?,34-,35?,36?/m1/s1 |
| InChIKey | UPINTBRTGVKOTN-VFYUYFRSSA-N |
| XLogP | 1.60 |
| TPSA | 178.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.78 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|