C32H51NO8V — CID 161264639
[(2S,4S,9S,10R,12R)-4-acetyloxy-1-hydroxy-2,9,10,12,14,17,17-heptamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl] 3-(dimethylamino)-2-methoxybutanoate;vanadium (PubChem CID 161264639) has the molecular formula C32H51NO8V and a molecular weight of 628.70 g/mol. Its IUPAC name is [(2S,4S,9S,10R,12R)-4-acetyloxy-1-hydroxy-2,9,10,12,14,17,17-heptamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl] 3-(dimethylamino)-2-methoxybutanoate;vanadium.
| Compound Name | [(2S,4S,9S,10R,12R)-4-acetyloxy-1-hydroxy-2,9,10,12,14,17,17-heptamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl] 3-(dimethylamino)-2-methoxybutanoate;vanadium |
|---|---|
| PubChem CID | 161264639 |
| Molecular Formula | C32H51NO8V |
| Molecular Weight | 628.70 g/mol |
| Exact Mass | 628.31 |
| IUPAC Name | [(2S,4S,9S,10R,12R)-4-acetyloxy-1-hydroxy-2,9,10,12,14,17,17-heptamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl] 3-(dimethylamino)-2-methoxybutanoate;vanadium |
| SMILES | COC(C(=O)OC1CC2(O)C(C)C3[C@]4(OC(C)=O)COC4C[C@H](C)[C@@]3(C)C(=O)[C@H](C)C(=C1C)C2(C)C)C(C)N(C)C.[V] |
| InChI | InChI=1S/C32H51NO8.V/c1-16-13-23-31(15-39-23,41-21(6)34)26-19(4)32(37)14-22(40-28(36)25(38-12)20(5)33(10)11)17(2)24(29(32,7)8)18(3)27(35)30(16,26)9;/h16,18-20,22-23,25-26,37H,13-15H2,1-12H3;/t16-,18+,19?,20?,22?,23?,25?,26?,30+,31-,32?;/m0./s1 |
| InChIKey | VDAAENUYDOWWAW-VJDAXBFWSA-N |
| XLogP | 3.56 |
| TPSA | 111.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.70 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|