C33H50NO12Si — CID 59872745
CID 59872745 (PubChem CID 59872745) has the molecular formula C33H50NO12Si and a molecular weight of 680.84 g/mol.
| Compound Name | CID 59872745 |
|---|---|
| PubChem CID | 59872745 |
| Molecular Formula | C33H50NO12Si |
| Molecular Weight | 680.84 g/mol |
| Exact Mass | 680.31 |
| IUPAC Name | — |
| SMILES | COCC(=O)OC1C(=O)[C@]2(C)C(O[Si])CC3OCC3(OC(C)=O)C2C(C)C2(O)CC(OC(=O)C(OC)C(C)N(C)C)C(C)=C1C2(C)C |
| InChI | InChI=1S/C33H50NO12Si/c1-16-20(43-29(38)25(41-11)18(3)34(8)9)13-33(39)17(2)27-31(7,21(46-47)12-22-32(27,15-42-22)45-19(4)35)28(37)26(24(16)30(33,5)6)44-23(36)14-40-10/h17-18,20-22,25-27,39H,12-15H2,1-11H3/t17?,18?,20?,21?,22?,25?,26?,27?,31-,32?,33?/m1/s1 |
| InChIKey | FUVCMVUZMIOSSI-OXPHQKDSSA-N |
| XLogP | 1.31 |
| TPSA | 156.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.84 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|