C32H43NO10 — CID 59952184
[(10S,12R)-1,2,4,9-tetrahydroxy-10,12,14,17,17-pentamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl] 3-acetamido-2-hydroxy-3-phenylpropanoate (PubChem CID 59952184) has the molecular formula C32H43NO10 and a molecular weight of 601.69 g/mol. Its IUPAC name is [(10S,12R)-1,2,4,9-tetrahydroxy-10,12,14,17,17-pentamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl] 3-acetamido-2-hydroxy-3-phenylpropanoate.
| Compound Name | [(10S,12R)-1,2,4,9-tetrahydroxy-10,12,14,17,17-pentamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl] 3-acetamido-2-hydroxy-3-phenylpropanoate |
|---|---|
| PubChem CID | 59952184 |
| Molecular Formula | C32H43NO10 |
| Molecular Weight | 601.69 g/mol |
| Exact Mass | 601.29 |
| IUPAC Name | [(10S,12R)-1,2,4,9-tetrahydroxy-10,12,14,17,17-pentamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl] 3-acetamido-2-hydroxy-3-phenylpropanoate |
| SMILES | CC(=O)NC(c1ccccc1)C(O)C(=O)OC1CC2(O)C(O)C3C4(O)COC4CC(O)[C@@]3(C)C(=O)[C@H](C)C(=C1C)C2(C)C |
| InChI | InChI=1S/C32H43NO10/c1-15-19(43-28(39)24(36)23(33-17(3)34)18-10-8-7-9-11-18)13-32(41)27(38)25-30(6,20(35)12-21-31(25,40)14-42-21)26(37)16(2)22(15)29(32,4)5/h7-11,16,19-21,23-25,27,35-36,38,40-41H,12-14H2,1-6H3,(H,33,34)/t16-,19?,20?,21?,23?,24?,25?,27?,30-,31?,32?/m1/s1 |
| InChIKey | YBTXUVOWLAMHNK-NSDMASSUSA-N |
| XLogP | 0.71 |
| TPSA | 182.85 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.69 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|