C30H43NO8S — CID 59898308
[(10S,12R)-1,4,9-trihydroxy-2,10,12,14,17,17-hexamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl] 2-hydroxy-3-(methylamino)-3-thiophen-2-ylpropanoate (PubChem CID 59898308) has the molecular formula C30H43NO8S and a molecular weight of 577.74 g/mol. Its IUPAC name is [(10S,12R)-1,4,9-trihydroxy-2,10,12,14,17,17-hexamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl] 2-hydroxy-3-(methylamino)-3-thiophen-2-ylpropanoate.
| Compound Name | [(10S,12R)-1,4,9-trihydroxy-2,10,12,14,17,17-hexamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl] 2-hydroxy-3-(methylamino)-3-thiophen-2-ylpropanoate |
|---|---|
| PubChem CID | 59898308 |
| Molecular Formula | C30H43NO8S |
| Molecular Weight | 577.74 g/mol |
| Exact Mass | 577.27 |
| IUPAC Name | [(10S,12R)-1,4,9-trihydroxy-2,10,12,14,17,17-hexamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl] 2-hydroxy-3-(methylamino)-3-thiophen-2-ylpropanoate |
| SMILES | CNC(c1cccs1)C(O)C(=O)OC1CC2(O)C(C)C3C4(O)COC4CC(O)[C@@]3(C)C(=O)[C@H](C)C(=C1C)C2(C)C |
| InChI | InChI=1S/C30H43NO8S/c1-14-17(39-26(35)23(33)22(31-7)18-9-8-10-40-18)12-30(37)16(3)24-28(6,19(32)11-20-29(24,36)13-38-20)25(34)15(2)21(14)27(30,4)5/h8-10,15-17,19-20,22-24,31-33,36-37H,11-13H2,1-7H3/t15-,16?,17?,19?,20?,22?,23?,24?,28-,29?,30?/m1/s1 |
| InChIKey | ZKAOBLSXNUYRLJ-QOCYRVHOSA-N |
| XLogP | 2.13 |
| TPSA | 145.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.74 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|