C30H40O10S — CID 158752006
[(1S,2S,3R,4S,7R,9S,10S,15S)-2-acetyloxy-1,4,9-trihydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl] (2R,3R)-2-hydroxy-3-thiophen-2-ylbutanoate (PubChem CID 158752006) has the molecular formula C30H40O10S and a molecular weight of 592.71 g/mol. Its IUPAC name is [(1S,2S,3R,4S,7R,9S,10S,15S)-2-acetyloxy-1,4,9-trihydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl] (2R,3R)-2-hydroxy-3-thiophen-2-ylbutanoate.
| Compound Name | [(1S,2S,3R,4S,7R,9S,10S,15S)-2-acetyloxy-1,4,9-trihydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl] (2R,3R)-2-hydroxy-3-thiophen-2-ylbutanoate |
|---|---|
| PubChem CID | 158752006 |
| Molecular Formula | C30H40O10S |
| Molecular Weight | 592.71 g/mol |
| Exact Mass | 592.23 |
| IUPAC Name | [(1S,2S,3R,4S,7R,9S,10S,15S)-2-acetyloxy-1,4,9-trihydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl] (2R,3R)-2-hydroxy-3-thiophen-2-ylbutanoate |
| SMILES | CC(=O)O[C@H]1[C@@H]2[C@]3(O)CO[C@@H]3C[C@H](O)[C@@]2(C)C(=O)CC2=C(C)[C@@H](OC(=O)[C@H](O)[C@@H](C)c3cccs3)C[C@]1(O)C2(C)C |
| InChI | InChI=1S/C30H40O10S/c1-14-17-10-20(32)28(6)21(33)11-22-29(36,13-38-22)24(28)25(39-16(3)31)30(37,27(17,4)5)12-18(14)40-26(35)23(34)15(2)19-8-7-9-41-19/h7-9,15,18,21-25,33-34,36-37H,10-13H2,1-6H3/t15-,18-,21-,22+,23+,24-,25-,28+,29-,30+/m0/s1 |
| InChIKey | VXFWATVDPKRQLX-ZLDQQHODSA-N |
| XLogP | 2.02 |
| TPSA | 159.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.71 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|