C28H41NO11 — CID 59058463
[(1S,2S,3R,4S,7R,10R,12R)-2-acetyloxy-1,4,12-trihydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl] (2R,3S)-3-acetamido-2-hydroxybutanoate (PubChem CID 59058463) has the molecular formula C28H41NO11 and a molecular weight of 567.63 g/mol. Its IUPAC name is [(1S,2S,3R,4S,7R,10R,12R)-2-acetyloxy-1,4,12-trihydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl] (2R,3S)-3-acetamido-2-hydroxybutanoate.
| Compound Name | [(1S,2S,3R,4S,7R,10R,12R)-2-acetyloxy-1,4,12-trihydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl] (2R,3S)-3-acetamido-2-hydroxybutanoate |
|---|---|
| PubChem CID | 59058463 |
| Molecular Formula | C28H41NO11 |
| Molecular Weight | 567.63 g/mol |
| Exact Mass | 567.27 |
| IUPAC Name | [(1S,2S,3R,4S,7R,10R,12R)-2-acetyloxy-1,4,12-trihydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl] (2R,3S)-3-acetamido-2-hydroxybutanoate |
| SMILES | CC(=O)N[C@@H](C)[C@@H](O)C(=O)OC1C[C@@]2(O)[C@@H](OC(C)=O)[C@@H]3[C@]4(O)CO[C@@H]4CC[C@@]3(C)C(=O)[C@H](O)C(=C1C)C2(C)C |
| InChI | InChI=1S/C28H41NO11/c1-12-16(40-24(35)19(32)13(2)29-14(3)30)10-28(37)23(39-15(4)31)21-26(7,9-8-17-27(21,36)11-38-17)22(34)20(33)18(12)25(28,5)6/h13,16-17,19-21,23,32-33,36-37H,8-11H2,1-7H3,(H,29,30)/t13-,16?,17+,19+,20+,21-,23-,26+,27-,28+/m0/s1 |
| InChIKey | NFBVRRJLBACDIU-BNSQETJOSA-N |
| XLogP | -0.32 |
| TPSA | 188.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.63 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|