C29H42AcO7Si — CID 59941468
actinium;(10S)-9-[dimethyl(phenyl)silyl]oxy-1,4,12,15-tetrahydroxy-2,10,14,17,17-pentamethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-11-one (PubChem CID 59941468) has the molecular formula C29H42AcO7Si and a molecular weight of 757.73 g/mol. Its IUPAC name is actinium;(10S)-9-[dimethyl(phenyl)silyl]oxy-1,4,12,15-tetrahydroxy-2,10,14,17,17-pentamethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-11-one.
| Compound Name | actinium;(10S)-9-[dimethyl(phenyl)silyl]oxy-1,4,12,15-tetrahydroxy-2,10,14,17,17-pentamethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-11-one |
|---|---|
| PubChem CID | 59941468 |
| Molecular Formula | C29H42AcO7Si |
| Molecular Weight | 757.73 g/mol |
| Exact Mass | 757.30 |
| IUPAC Name | actinium;(10S)-9-[dimethyl(phenyl)silyl]oxy-1,4,12,15-tetrahydroxy-2,10,14,17,17-pentamethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-11-one |
| SMILES | CC1=C2C(O)C(=O)[C@]3(C)C(O[Si](C)(C)c4ccccc4)CC4OCC4(O)C3C(C)C(O)(CC1O)C2(C)C.[Ac] |
| InChI | InChI=1S/C29H42O7Si.Ac/c1-16-19(30)14-29(34)17(2)24-27(5,25(32)23(31)22(16)26(29,3)4)20(13-21-28(24,33)15-35-21)36-37(6,7)18-11-9-8-10-12-18;/h8-12,17,19-21,23-24,30-31,33-34H,13-15H2,1-7H3;/t17?,19?,20?,21?,23?,24?,27-,28?,29?;/m1./s1 |
| InChIKey | XHBBDOCKBQSQPI-RGHJRUFYSA-N |
| XLogP | 2.06 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.73 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|