C28H48O8Si — CID 163810966
(1S,2S,3R,4S,7R,9S,10S,12R,15S)-1,2,4-trihydroxy-9,12-dimethoxy-10,14,17,17-tetramethyl-15-triethylsilyloxy-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-11-one (PubChem CID 163810966) has the molecular formula C28H48O8Si and a molecular weight of 540.77 g/mol. Its IUPAC name is (1S,2S,3R,4S,7R,9S,10S,12R,15S)-1,2,4-trihydroxy-9,12-dimethoxy-10,14,17,17-tetramethyl-15-triethylsilyloxy-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-11-one.
| Compound Name | (1S,2S,3R,4S,7R,9S,10S,12R,15S)-1,2,4-trihydroxy-9,12-dimethoxy-10,14,17,17-tetramethyl-15-triethylsilyloxy-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-11-one |
|---|---|
| PubChem CID | 163810966 |
| Molecular Formula | C28H48O8Si |
| Molecular Weight | 540.77 g/mol |
| Exact Mass | 540.31 |
| IUPAC Name | (1S,2S,3R,4S,7R,9S,10S,12R,15S)-1,2,4-trihydroxy-9,12-dimethoxy-10,14,17,17-tetramethyl-15-triethylsilyloxy-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-11-one |
| SMILES | CC[Si](CC)(CC)O[C@H]1C[C@@]2(O)[C@@H](O)[C@@H]3[C@]4(O)CO[C@@H]4C[C@H](OC)[C@@]3(C)C(=O)[C@H](OC)C(=C1C)C2(C)C |
| InChI | InChI=1S/C28H48O8Si/c1-10-37(11-2,12-3)36-17-14-28(32)24(30)22-26(7,18(33-8)13-19-27(22,31)15-35-19)23(29)21(34-9)20(16(17)4)25(28,5)6/h17-19,21-22,24,30-32H,10-15H2,1-9H3/t17-,18-,19+,21+,22-,24-,26+,27-,28+/m0/s1 |
| InChIKey | NNEUMMJQMQVUAB-KFVFDAFSSA-N |
| XLogP | 2.98 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.77 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|