C40H51AcNO9 — CID 59875702
actinium;[(2S,10S)-1,4-dihydroxy-9,12-dimethoxy-2,10,14,17,17-pentamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl] (2R)-3-benzamido-2-methyl-3-phenylpropanoate (PubChem CID 59875702) has the molecular formula C40H51AcNO9 and a molecular weight of 916.85 g/mol. Its IUPAC name is actinium;[(2S,10S)-1,4-dihydroxy-9,12-dimethoxy-2,10,14,17,17-pentamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl] (2R)-3-benzamido-2-methyl-3-phenylpropanoate.
| Compound Name | actinium;[(2S,10S)-1,4-dihydroxy-9,12-dimethoxy-2,10,14,17,17-pentamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl] (2R)-3-benzamido-2-methyl-3-phenylpropanoate |
|---|---|
| PubChem CID | 59875702 |
| Molecular Formula | C40H51AcNO9 |
| Molecular Weight | 916.85 g/mol |
| Exact Mass | 916.38 |
| IUPAC Name | actinium;[(2S,10S)-1,4-dihydroxy-9,12-dimethoxy-2,10,14,17,17-pentamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl] (2R)-3-benzamido-2-methyl-3-phenylpropanoate |
| SMILES | COC1C(=O)[C@]2(C)C(OC)CC3OCC3(O)C2[C@H](C)C2(O)CC(OC(=O)[C@H](C)C(NC(=O)c3ccccc3)c3ccccc3)C(C)=C1C2(C)C.[Ac] |
| InChI | InChI=1S/C40H51NO9.Ac/c1-22-27(50-36(44)23(2)31(25-15-11-9-12-16-25)41-35(43)26-17-13-10-14-18-26)20-40(46)24(3)33-38(6,28(47-7)19-29-39(33,45)21-49-29)34(42)32(48-8)30(22)37(40,4)5;/h9-18,23-24,27-29,31-33,45-46H,19-21H2,1-8H3,(H,41,43);/t23-,24+,27?,28?,29?,31?,32?,33?,38-,39?,40?;/m1./s1 |
| InChIKey | OMOKQWGVIDJOOO-RHQGOPDWSA-N |
| XLogP | 4.59 |
| TPSA | 140.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 916.85 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|