C39H49AcNO10 — CID 59875705
actinium;[(2S,10S)-1,4-dihydroxy-9,12-dimethoxy-2,10,14,17,17-pentamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl] 3-benzamido-2-hydroxy-3-phenylpropanoate (PubChem CID 59875705) has the molecular formula C39H49AcNO10 and a molecular weight of 918.82 g/mol. Its IUPAC name is actinium;[(2S,10S)-1,4-dihydroxy-9,12-dimethoxy-2,10,14,17,17-pentamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl] 3-benzamido-2-hydroxy-3-phenylpropanoate.
| Compound Name | actinium;[(2S,10S)-1,4-dihydroxy-9,12-dimethoxy-2,10,14,17,17-pentamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl] 3-benzamido-2-hydroxy-3-phenylpropanoate |
|---|---|
| PubChem CID | 59875705 |
| Molecular Formula | C39H49AcNO10 |
| Molecular Weight | 918.82 g/mol |
| Exact Mass | 918.36 |
| IUPAC Name | actinium;[(2S,10S)-1,4-dihydroxy-9,12-dimethoxy-2,10,14,17,17-pentamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl] 3-benzamido-2-hydroxy-3-phenylpropanoate |
| SMILES | COC1C(=O)[C@]2(C)C(OC)CC3OCC3(O)C2[C@H](C)C2(O)CC(OC(=O)C(O)C(NC(=O)c3ccccc3)c3ccccc3)C(C)=C1C2(C)C.[Ac] |
| InChI | InChI=1S/C39H49NO10.Ac/c1-21-25(50-35(44)30(41)29(23-14-10-8-11-15-23)40-34(43)24-16-12-9-13-17-24)19-39(46)22(2)32-37(5,26(47-6)18-27-38(32,45)20-49-27)33(42)31(48-7)28(21)36(39,3)4;/h8-17,22,25-27,29-32,41,45-46H,18-20H2,1-7H3,(H,40,43);/t22-,25?,26?,27?,29?,30?,31?,32?,37+,38?,39?;/m0./s1 |
| InChIKey | IIUKEQHNHPNVIL-GXOPCELHSA-N |
| XLogP | 3.31 |
| TPSA | 160.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 918.82 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|