C35H58O10Si2 — CID 10886996
[(1S,5S,6R,7S,10R,12S,13S,15R,18S)-7-hydroxy-13,17,20,20-tetramethyl-3,14-dioxo-12,18-bis(triethylsilyloxy)-2,4,9-trioxapentacyclo[14.3.1.01,5.06,13.07,10]icos-16-en-15-yl] acetate (PubChem CID 10886996) has the molecular formula C35H58O10Si2 and a molecular weight of 695.01 g/mol. Its IUPAC name is [(1S,5S,6R,7S,10R,12S,13S,15R,18S)-7-hydroxy-13,17,20,20-tetramethyl-3,14-dioxo-12,18-bis(triethylsilyloxy)-2,4,9-trioxapentacyclo[14.3.1.01,5.06,13.07,10]icos-16-en-15-yl] acetate.
| Compound Name | [(1S,5S,6R,7S,10R,12S,13S,15R,18S)-7-hydroxy-13,17,20,20-tetramethyl-3,14-dioxo-12,18-bis(triethylsilyloxy)-2,4,9-trioxapentacyclo[14.3.1.01,5.06,13.07,10]icos-16-en-15-yl] acetate |
|---|---|
| PubChem CID | 10886996 |
| Molecular Formula | C35H58O10Si2 |
| Molecular Weight | 695.01 g/mol |
| Exact Mass | 694.36 |
| IUPAC Name | [(1S,5S,6R,7S,10R,12S,13S,15R,18S)-7-hydroxy-13,17,20,20-tetramethyl-3,14-dioxo-12,18-bis(triethylsilyloxy)-2,4,9-trioxapentacyclo[14.3.1.01,5.06,13.07,10]icos-16-en-15-yl] acetate |
| SMILES | CC[Si](CC)(CC)O[C@H]1C[C@@]23OC(=O)O[C@H]2[C@@H]2[C@]4(O)CO[C@@H]4C[C@H](O[Si](CC)(CC)CC)[C@@]2(C)C(=O)[C@H](OC(C)=O)C(=C1C)C3(C)C |
| InChI | InChI=1S/C35H58O10Si2/c1-12-46(13-2,14-3)44-23-19-35-30(42-31(38)43-35)28-33(11,29(37)27(41-22(8)36)26(21(23)7)32(35,9)10)24(18-25-34(28,39)20-40-25)45-47(15-4,16-5)17-6/h23-25,27-28,30,39H,12-20H2,1-11H3/t23-,24-,25+,27+,28-,30-,33+,34-,35+/m0/s1 |
| InChIKey | VXYJXEQXAFEFPA-NIWDXWTNSA-N |
| XLogP | 6.46 |
| TPSA | 126.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.01 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|