C32H46O7Si — CID 161015074
[(1S,4S,7R,9S,10R,12R,15S)-1,4-dihydroxy-9,10,12,14,17,17-hexamethyl-11-oxo-15-trimethylsilyloxy-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate (PubChem CID 161015074) has the molecular formula C32H46O7Si and a molecular weight of 570.80 g/mol. Its IUPAC name is [(1S,4S,7R,9S,10R,12R,15S)-1,4-dihydroxy-9,10,12,14,17,17-hexamethyl-11-oxo-15-trimethylsilyloxy-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate.
| Compound Name | [(1S,4S,7R,9S,10R,12R,15S)-1,4-dihydroxy-9,10,12,14,17,17-hexamethyl-11-oxo-15-trimethylsilyloxy-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate |
|---|---|
| PubChem CID | 161015074 |
| Molecular Formula | C32H46O7Si |
| Molecular Weight | 570.80 g/mol |
| Exact Mass | 570.30 |
| IUPAC Name | [(1S,4S,7R,9S,10R,12R,15S)-1,4-dihydroxy-9,10,12,14,17,17-hexamethyl-11-oxo-15-trimethylsilyloxy-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate |
| SMILES | CC1=C2[C@@H](C)C(=O)[C@@]3(C)C(C(OC(=O)c4ccccc4)[C@](O)(C[C@@H]1O[Si](C)(C)C)C2(C)C)[C@]1(O)CO[C@@H]1C[C@@H]3C |
| InChI | InChI=1S/C32H46O7Si/c1-18-15-23-31(35,17-37-23)25-27(38-28(34)21-13-11-10-12-14-21)32(36)16-22(39-40(7,8)9)19(2)24(29(32,4)5)20(3)26(33)30(18,25)6/h10-14,18,20,22-23,25,27,35-36H,15-17H2,1-9H3/t18-,20+,22-,23+,25?,27?,30+,31-,32+/m0/s1 |
| InChIKey | FQWNJTGWKIQQOE-FZGAWELOSA-N |
| XLogP | 4.92 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.80 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|