C35H48AcO9 — CID 162003054
actinium;[(4S,10S,12R)-1,4-dihydroxy-15-(2-hydroxy-3-methylbutanoyl)oxy-9,9,10,12,14,17,17-heptamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate (PubChem CID 162003054) has the molecular formula C35H48AcO9 and a molecular weight of 839.76 g/mol. Its IUPAC name is actinium;[(4S,10S,12R)-1,4-dihydroxy-15-(2-hydroxy-3-methylbutanoyl)oxy-9,9,10,12,14,17,17-heptamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate.
| Compound Name | actinium;[(4S,10S,12R)-1,4-dihydroxy-15-(2-hydroxy-3-methylbutanoyl)oxy-9,9,10,12,14,17,17-heptamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate |
|---|---|
| PubChem CID | 162003054 |
| Molecular Formula | C35H48AcO9 |
| Molecular Weight | 839.76 g/mol |
| Exact Mass | 839.36 |
| IUPAC Name | actinium;[(4S,10S,12R)-1,4-dihydroxy-15-(2-hydroxy-3-methylbutanoyl)oxy-9,9,10,12,14,17,17-heptamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate |
| SMILES | CC1=C2[C@@H](C)C(=O)[C@@]3(C)C(C(OC(=O)c4ccccc4)C(O)(CC1OC(=O)C(O)C(C)C)C2(C)C)[C@]1(O)COC1CC3(C)C.[Ac] |
| InChI | InChI=1S/C35H48O9.Ac/c1-18(2)25(36)30(39)43-22-15-35(41)28(44-29(38)21-13-11-10-12-14-21)26-33(9,31(5,6)16-23-34(26,40)17-42-23)27(37)20(4)24(19(22)3)32(35,7)8;/h10-14,18,20,22-23,25-26,28,36,40-41H,15-17H2,1-9H3;/t20-,22?,23?,25?,26?,28?,33-,34+,35?;/m1./s1 |
| InChIKey | RFMCGFBACICTJA-LWVZBVACSA-N |
| XLogP | 4.02 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 839.76 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|