C35H48O10 — CID 157247690
[(4S,10S)-15-[(2R)-2,3-dimethylbutanoyl]oxy-9-ethoxy-1,4,12-trihydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate (PubChem CID 157247690) has the molecular formula C35H48O10 and a molecular weight of 628.76 g/mol. Its IUPAC name is [(4S,10S)-15-[(2R)-2,3-dimethylbutanoyl]oxy-9-ethoxy-1,4,12-trihydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate.
| Compound Name | [(4S,10S)-15-[(2R)-2,3-dimethylbutanoyl]oxy-9-ethoxy-1,4,12-trihydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate |
|---|---|
| PubChem CID | 157247690 |
| Molecular Formula | C35H48O10 |
| Molecular Weight | 628.76 g/mol |
| Exact Mass | 628.32 |
| IUPAC Name | [(4S,10S)-15-[(2R)-2,3-dimethylbutanoyl]oxy-9-ethoxy-1,4,12-trihydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate |
| SMILES | CCOC1CC2OC[C@@]2(O)C2C(OC(=O)c3ccccc3)C3(O)CC(OC(=O)[C@H](C)C(C)C)C(C)=C(C(O)C(=O)[C@]12C)C3(C)C |
| InChI | InChI=1S/C35H48O10/c1-9-42-23-15-24-34(40,17-43-24)27-29(45-31(39)21-13-11-10-12-14-21)35(41)16-22(44-30(38)19(4)18(2)3)20(5)25(32(35,6)7)26(36)28(37)33(23,27)8/h10-14,18-19,22-24,26-27,29,36,40-41H,9,15-17H2,1-8H3/t19-,22?,23?,24?,26?,27?,29?,33-,34+,35?/m1/s1 |
| InChIKey | ZAPVQCNMGAYSIW-KRWLBFIESA-N |
| XLogP | 3.40 |
| TPSA | 148.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.76 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|