C33H44Ac2O10 — CID 59911644
actinium;[(10S)-15-[(2R)-2,3-dimethylbutanoyl]oxy-1,4,9,12-tetrahydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate (PubChem CID 59911644) has the molecular formula C33H44Ac2O10 and a molecular weight of 1054.70 g/mol. Its IUPAC name is actinium;[(10S)-15-[(2R)-2,3-dimethylbutanoyl]oxy-1,4,9,12-tetrahydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate.
| Compound Name | actinium;[(10S)-15-[(2R)-2,3-dimethylbutanoyl]oxy-1,4,9,12-tetrahydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate |
|---|---|
| PubChem CID | 59911644 |
| Molecular Formula | C33H44Ac2O10 |
| Molecular Weight | 1054.70 g/mol |
| Exact Mass | 1054.35 |
| IUPAC Name | actinium;[(10S)-15-[(2R)-2,3-dimethylbutanoyl]oxy-1,4,9,12-tetrahydroxy-10,14,17,17-tetramethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-2-yl] benzoate |
| SMILES | CC1=C2C(O)C(=O)[C@]3(C)C(O)CC4OCC4(O)C3C(OC(=O)c3ccccc3)C(O)(CC1OC(=O)[C@H](C)C(C)C)C2(C)C.[Ac].[Ac] |
| InChI | InChI=1S/C33H44O10.2Ac/c1-16(2)17(3)28(37)42-20-14-33(40)27(43-29(38)19-11-9-8-10-12-19)25-31(7,21(34)13-22-32(25,39)15-41-22)26(36)24(35)23(18(20)4)30(33,5)6;;/h8-12,16-17,20-22,24-25,27,34-35,39-40H,13-15H2,1-7H3;;/t17-,20?,21?,22?,24?,25?,27?,31-,32?,33?;;/m1../s1 |
| InChIKey | RYARYAOSOWUCIF-ZEUJWWAQSA-N |
| XLogP | 2.35 |
| TPSA | 159.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 1054.70 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|