C24H36O8 — CID 59941484
[(10S)-1,4,9,15-tetrahydroxy-2,10,14,17,17-pentamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-12-yl] propanoate (PubChem CID 59941484) has the molecular formula C24H36O8 and a molecular weight of 452.54 g/mol. Its IUPAC name is [(10S)-1,4,9,15-tetrahydroxy-2,10,14,17,17-pentamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-12-yl] propanoate.
| Compound Name | [(10S)-1,4,9,15-tetrahydroxy-2,10,14,17,17-pentamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-12-yl] propanoate |
|---|---|
| PubChem CID | 59941484 |
| Molecular Formula | C24H36O8 |
| Molecular Weight | 452.54 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | [(10S)-1,4,9,15-tetrahydroxy-2,10,14,17,17-pentamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-12-yl] propanoate |
| SMILES | CCC(=O)OC1C(=O)[C@]2(C)C(O)CC3OCC3(O)C2C(C)C2(O)CC(O)C(C)=C1C2(C)C |
| InChI | InChI=1S/C24H36O8/c1-7-16(27)32-18-17-11(2)13(25)9-24(30,21(17,4)5)12(3)19-22(6,20(18)28)14(26)8-15-23(19,29)10-31-15/h12-15,18-19,25-26,29-30H,7-10H2,1-6H3/t12?,13?,14?,15?,18?,19?,22-,23?,24?/m1/s1 |
| InChIKey | RFMKXJDSYJQXJQ-AHIFSEJXSA-N |
| XLogP | 0.88 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.54 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|