C30H46O13 — CID 59971277
[(2S,7R,10S)-1,4,9,15-tetrahydroxy-2,10,14,17,17-pentamethyl-11-oxo-12-tetracyclo[11.3.1.03,10.04,7]heptadec-13-enyl] 2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyacetate (PubChem CID 59971277) has the molecular formula C30H46O13 and a molecular weight of 614.69 g/mol. Its IUPAC name is [(2S,7R,10S)-1,4,9,15-tetrahydroxy-2,10,14,17,17-pentamethyl-11-oxo-12-tetracyclo[11.3.1.03,10.04,7]heptadec-13-enyl] 2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyacetate.
| Compound Name | [(2S,7R,10S)-1,4,9,15-tetrahydroxy-2,10,14,17,17-pentamethyl-11-oxo-12-tetracyclo[11.3.1.03,10.04,7]heptadec-13-enyl] 2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyacetate |
|---|---|
| PubChem CID | 59971277 |
| Molecular Formula | C30H46O13 |
| Molecular Weight | 614.69 g/mol |
| Exact Mass | 614.29 |
| IUPAC Name | [(2S,7R,10S)-1,4,9,15-tetrahydroxy-2,10,14,17,17-pentamethyl-11-oxo-12-tetracyclo[11.3.1.03,10.04,7]heptadec-13-enyl] 2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyacetate |
| SMILES | CC1=C2C(OC(=O)COC3OC(CO)C(O)C(O)C3O)C(=O)[C@]3(C)C(O)C[C@H]4CCC4(O)C3[C@H](C)C(O)(CC1O)C2(C)C |
| InChI | InChI=1S/C30H46O13/c1-12-15(32)9-30(40)13(2)24-28(5,17(33)8-14-6-7-29(14,24)39)25(38)23(19(12)27(30,3)4)43-18(34)11-41-26-22(37)21(36)20(35)16(10-31)42-26/h13-17,20-24,26,31-33,35-37,39-40H,6-11H2,1-5H3/t13-,14+,15?,16?,17?,20?,21?,22?,23?,24?,26?,28+,29?,30?/m0/s1 |
| InChIKey | VYTMBDJLJISPQF-BSMVOHTJSA-N |
| XLogP | -1.70 |
| TPSA | 223.67 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.69 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|