C27H42O8 — CID 59111452
[(7R,10S)-1,4,9,12-tetrahydroxy-2,10,14,17,17-pentamethyl-11-oxo-15-tetracyclo[11.3.1.03,10.04,7]heptadec-13-enyl] 2-hydroxy-3-methylbutanoate (PubChem CID 59111452) has the molecular formula C27H42O8 and a molecular weight of 494.63 g/mol. Its IUPAC name is [(7R,10S)-1,4,9,12-tetrahydroxy-2,10,14,17,17-pentamethyl-11-oxo-15-tetracyclo[11.3.1.03,10.04,7]heptadec-13-enyl] 2-hydroxy-3-methylbutanoate.
| Compound Name | [(7R,10S)-1,4,9,12-tetrahydroxy-2,10,14,17,17-pentamethyl-11-oxo-15-tetracyclo[11.3.1.03,10.04,7]heptadec-13-enyl] 2-hydroxy-3-methylbutanoate |
|---|---|
| PubChem CID | 59111452 |
| Molecular Formula | C27H42O8 |
| Molecular Weight | 494.63 g/mol |
| Exact Mass | 494.29 |
| IUPAC Name | [(7R,10S)-1,4,9,12-tetrahydroxy-2,10,14,17,17-pentamethyl-11-oxo-15-tetracyclo[11.3.1.03,10.04,7]heptadec-13-enyl] 2-hydroxy-3-methylbutanoate |
| SMILES | CC1=C2C(O)C(=O)[C@]3(C)C(O)C[C@H]4CCC4(O)C3C(C)C(O)(CC1OC(=O)C(O)C(C)C)C2(C)C |
| InChI | InChI=1S/C27H42O8/c1-12(2)19(29)23(32)35-16-11-27(34)14(4)21-25(7,17(28)10-15-8-9-26(15,21)33)22(31)20(30)18(13(16)3)24(27,5)6/h12,14-17,19-21,28-30,33-34H,8-11H2,1-7H3/t14?,15-,16?,17?,19?,20?,21?,25-,26?,27?/m1/s1 |
| InChIKey | YIWKXASDZGHKDA-HPUURONHSA-N |
| XLogP | 1.50 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.63 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|