C31H40O10 — CID 74074702
(4-acetyloxy-1,9,15-trihydroxy-10,14,17,17-tetramethyl-11-oxo-2-phenylmethoxy-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-12-yl) acetate (PubChem CID 74074702) has the molecular formula C31H40O10 and a molecular weight of 572.65 g/mol. Its IUPAC name is (4-acetyloxy-1,9,15-trihydroxy-10,14,17,17-tetramethyl-11-oxo-2-phenylmethoxy-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-12-yl) acetate.
| Compound Name | (4-acetyloxy-1,9,15-trihydroxy-10,14,17,17-tetramethyl-11-oxo-2-phenylmethoxy-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-12-yl) acetate |
|---|---|
| PubChem CID | 74074702 |
| Molecular Formula | C31H40O10 |
| Molecular Weight | 572.65 g/mol |
| Exact Mass | 572.26 |
| IUPAC Name | (4-acetyloxy-1,9,15-trihydroxy-10,14,17,17-tetramethyl-11-oxo-2-phenylmethoxy-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-12-yl) acetate |
| SMILES | CC(=O)OC1C(=O)C2(C)C(O)CC3OCC3(OC(C)=O)C2C(OCc2ccccc2)C2(O)CC(O)C(C)=C1C2(C)C |
| InChI | InChI=1S/C31H40O10/c1-16-20(34)13-31(37)27(38-14-19-10-8-7-9-11-19)25-29(6,21(35)12-22-30(25,15-39-22)41-18(3)33)26(36)24(40-17(2)32)23(16)28(31,4)5/h7-11,20-22,24-25,27,34-35,37H,12-15H2,1-6H3 |
| InChIKey | BKASSTPDSANLBH-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 148.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.65 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|