C33H46Ac2O9 — CID 157282529
actinium;[(2S,4S,10S)-1,4,12-trihydroxy-9-methoxy-2,3,10,14,17,17-hexamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl] (3S)-2-hydroxy-3-phenylbutanoate (PubChem CID 157282529) has the molecular formula C33H46Ac2O9 and a molecular weight of 1040.72 g/mol. Its IUPAC name is actinium;[(2S,4S,10S)-1,4,12-trihydroxy-9-methoxy-2,3,10,14,17,17-hexamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl] (3S)-2-hydroxy-3-phenylbutanoate.
| Compound Name | actinium;[(2S,4S,10S)-1,4,12-trihydroxy-9-methoxy-2,3,10,14,17,17-hexamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl] (3S)-2-hydroxy-3-phenylbutanoate |
|---|---|
| PubChem CID | 157282529 |
| Molecular Formula | C33H46Ac2O9 |
| Molecular Weight | 1040.72 g/mol |
| Exact Mass | 1040.37 |
| IUPAC Name | actinium;[(2S,4S,10S)-1,4,12-trihydroxy-9-methoxy-2,3,10,14,17,17-hexamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl] (3S)-2-hydroxy-3-phenylbutanoate |
| SMILES | COC1CC2OC[C@@]2(O)C2(C)[C@H](C)C3(O)CC(OC(=O)C(O)[C@@H](C)c4ccccc4)C(C)=C(C(O)C(=O)[C@]12C)C3(C)C.[Ac].[Ac] |
| InChI | InChI=1S/C33H46O9.2Ac/c1-17(20-12-10-9-11-13-20)25(34)28(37)42-21-15-32(38)19(3)31(7)30(6,22(40-8)14-23-33(31,39)16-41-23)27(36)26(35)24(18(21)2)29(32,4)5;;/h9-13,17,19,21-23,25-26,34-35,38-39H,14-16H2,1-8H3;;/t17-,19-,21?,22?,23?,25?,26?,30-,31?,32?,33-;;/m0../s1 |
| InChIKey | ZPECNSOBOADLQF-PLOVKLBNSA-N |
| XLogP | 2.68 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 1040.72 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|