C31H44O10 — CID 159951666
[(2S,4S,10S)-1,4,12-trihydroxy-9-methoxy-2,3,10,14,17,17-hexamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl] (3R)-3-(furan-2-yl)-2-hydroxybutanoate (PubChem CID 159951666) has the molecular formula C31H44O10 and a molecular weight of 576.68 g/mol. Its IUPAC name is [(2S,4S,10S)-1,4,12-trihydroxy-9-methoxy-2,3,10,14,17,17-hexamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl] (3R)-3-(furan-2-yl)-2-hydroxybutanoate.
| Compound Name | [(2S,4S,10S)-1,4,12-trihydroxy-9-methoxy-2,3,10,14,17,17-hexamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl] (3R)-3-(furan-2-yl)-2-hydroxybutanoate |
|---|---|
| PubChem CID | 159951666 |
| Molecular Formula | C31H44O10 |
| Molecular Weight | 576.68 g/mol |
| Exact Mass | 576.29 |
| IUPAC Name | [(2S,4S,10S)-1,4,12-trihydroxy-9-methoxy-2,3,10,14,17,17-hexamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl] (3R)-3-(furan-2-yl)-2-hydroxybutanoate |
| SMILES | COC1CC2OC[C@@]2(O)C2(C)[C@H](C)C3(O)CC(OC(=O)C(O)[C@@H](C)c4ccco4)C(C)=C(C(O)C(=O)[C@]12C)C3(C)C |
| InChI | InChI=1S/C31H44O10/c1-15-19(41-26(35)23(32)16(2)18-10-9-11-39-18)13-30(36)17(3)29(7)28(6,25(34)24(33)22(15)27(30,4)5)20(38-8)12-21-31(29,37)14-40-21/h9-11,16-17,19-21,23-24,32-33,36-37H,12-14H2,1-8H3/t16-,17-,19?,20?,21?,23?,24?,28-,29?,30?,31-/m0/s1 |
| InChIKey | VTYCOSQVAZWBOQ-RFBSZVHGSA-N |
| XLogP | 2.27 |
| TPSA | 155.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.68 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|