C30H42O11 — CID 101423025
[(1'R,2S,3'R,8'S)-2',5',9',10'-tetraacetyloxy-8',12',15',15'-tetramethylspiro[oxirane-2,4'-tricyclo[9.3.1.03,8]pentadec-11-ene]-7'-yl] acetate (PubChem CID 101423025) has the molecular formula C30H42O11 and a molecular weight of 578.66 g/mol. Its IUPAC name is [(1'R,2S,3'R,8'S)-2',5',9',10'-tetraacetyloxy-8',12',15',15'-tetramethylspiro[oxirane-2,4'-tricyclo[9.3.1.03,8]pentadec-11-ene]-7'-yl] acetate.
| Compound Name | [(1'R,2S,3'R,8'S)-2',5',9',10'-tetraacetyloxy-8',12',15',15'-tetramethylspiro[oxirane-2,4'-tricyclo[9.3.1.03,8]pentadec-11-ene]-7'-yl] acetate |
|---|---|
| PubChem CID | 101423025 |
| Molecular Formula | C30H42O11 |
| Molecular Weight | 578.66 g/mol |
| Exact Mass | 578.27 |
| IUPAC Name | [(1'R,2S,3'R,8'S)-2',5',9',10'-tetraacetyloxy-8',12',15',15'-tetramethylspiro[oxirane-2,4'-tricyclo[9.3.1.03,8]pentadec-11-ene]-7'-yl] acetate |
| SMILES | CC(=O)OC1C2=C(C)CC[C@@H](C(OC(C)=O)[C@H]3[C@@](C)(C(OC(C)=O)CC(OC(C)=O)[C@@]34CO4)C1OC(C)=O)C2(C)C |
| InChI | InChI=1S/C30H42O11/c1-14-10-11-20-24(39-17(4)33)26-29(9,21(37-15(2)31)12-22(38-16(3)32)30(26)13-36-30)27(41-19(6)35)25(40-18(5)34)23(14)28(20,7)8/h20-22,24-27H,10-13H2,1-9H3/t20-,21?,22?,24?,25?,26-,27?,29+,30-/m0/s1 |
| InChIKey | WNZADBUCPRQCCO-XEEQOOEBSA-N |
| XLogP | 3.21 |
| TPSA | 144.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.66 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|