C26H36O9 — CID 15403317
[(1R,2R,3S,4S,7R,8R,9R)-8,9-diacetyloxy-4-formyl-4-(hydroxymethyl)-7,11,14,14-tetramethyl-12-oxo-2-tricyclo[8.3.1.03,7]tetradec-10-enyl] acetate (PubChem CID 15403317) has the molecular formula C26H36O9 and a molecular weight of 492.57 g/mol. Its IUPAC name is [(1R,2R,3S,4S,7R,8R,9R)-8,9-diacetyloxy-4-formyl-4-(hydroxymethyl)-7,11,14,14-tetramethyl-12-oxo-2-tricyclo[8.3.1.03,7]tetradec-10-enyl] acetate.
| Compound Name | [(1R,2R,3S,4S,7R,8R,9R)-8,9-diacetyloxy-4-formyl-4-(hydroxymethyl)-7,11,14,14-tetramethyl-12-oxo-2-tricyclo[8.3.1.03,7]tetradec-10-enyl] acetate |
|---|---|
| PubChem CID | 15403317 |
| Molecular Formula | C26H36O9 |
| Molecular Weight | 492.57 g/mol |
| Exact Mass | 492.24 |
| IUPAC Name | [(1R,2R,3S,4S,7R,8R,9R)-8,9-diacetyloxy-4-formyl-4-(hydroxymethyl)-7,11,14,14-tetramethyl-12-oxo-2-tricyclo[8.3.1.03,7]tetradec-10-enyl] acetate |
| SMILES | CC(=O)O[C@H]1[C@@H]2[C@](C=O)(CO)CC[C@@]2(C)[C@@H](OC(C)=O)[C@H](OC(C)=O)C2=C(C)C(=O)C[C@@H]1C2(C)C |
| InChI | InChI=1S/C26H36O9/c1-13-18(32)10-17-20(33-14(2)29)22-25(7,8-9-26(22,11-27)12-28)23(35-16(4)31)21(34-15(3)30)19(13)24(17,5)6/h11,17,20-23,28H,8-10,12H2,1-7H3/t17-,20+,21+,22-,23-,25+,26+/m0/s1 |
| InChIKey | GBAYPZFPNUESER-UMXGCZPUSA-N |
| XLogP | 2.32 |
| TPSA | 133.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.57 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|